Difference between revisions of "CPD1F-97"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...") |
(Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7526 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9,9'-di-cis-ζ-carotene |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** biwlelkafxrpde-zurblsrnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 540.914 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11354]] |
| − | * [[RXN- | + | * [[RXN-11356]] |
| + | * [[RXN-12242]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11354]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9,9'-di-cis-ζ-carotene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=biwlelkafxrpde-zurblsrnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=540.914}} |
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-7526
- common-name:
- 9,9'-di-cis-ζ-carotene
- smiles:
- cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- biwlelkafxrpde-zurblsrnsa-n
- molecular-weight:
- 540.914
