Difference between revisions of "16S-rRNA-N4-methylcytidine1402"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MALONATE-S-ALD == * common-name: ** 3-oxopropanoate * smiles: ** [ch](=o)cc([o-])=o * inchi-key: ** oakurxizzoaybc-uhfffaoysa-m * molecul...") |
(Created page with "Category:metabolite == Metabolite CPD-12676 == * common-name: ** 5'-chloro-5'-deoxyadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12676 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-chloro-5'-deoxyadenosine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iysnpomtkfzdhz-kqynxxcusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 285.689 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-11715]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-chloro-5'-deoxyadenosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iysnpomtkfzdhz-kqynxxcusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=285.689}} |
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-12676
- common-name:
- 5'-chloro-5'-deoxyadenosine
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl
- inchi-key:
- iysnpomtkfzdhz-kqynxxcusa-n
- molecular-weight:
- 285.689
