Difference between revisions of "CPD-7616"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12122 == * common-name: ** demethylmenaquinol-13 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite MALONATE-S-ALD == * common-name: ** 3-oxopropanoate * smiles: ** [ch](=o)cc([o-])=o * inchi-key: ** oakurxizzoaybc-uhfffaoysa-m * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12122 ==
+
== Metabolite MALONATE-S-ALD ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-13
+
** 3-oxopropanoate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
+
** [ch](=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** hpjvtyodwhyfmv-znwikrofsa-n
+
** oakurxizzoaybc-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1045.709
+
** 87.055
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9366]]
+
* [[1.2.1.18-RXN]]
 +
* [[RXN-2901]]
 +
* [[RXN-2902]]
 +
* [[RXN-9958]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.2.1.18-RXN]]
 +
* [[RXN-16322]]
 +
* [[RXN-2901]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-13}}
+
{{#set: common-name=3-oxopropanoate}}
{{#set: inchi-key=inchikey=hpjvtyodwhyfmv-znwikrofsa-n}}
+
{{#set: inchi-key=inchikey=oakurxizzoaybc-uhfffaoysa-m}}
{{#set: molecular-weight=1045.709}}
+
{{#set: molecular-weight=87.055}}

Revision as of 18:57, 14 January 2021

Metabolite MALONATE-S-ALD

  • common-name:
    • 3-oxopropanoate
  • smiles:
    • [ch](=o)cc([o-])=o
  • inchi-key:
    • oakurxizzoaybc-uhfffaoysa-m
  • molecular-weight:
    • 87.055

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality