Difference between revisions of "CPD-14423"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...") |
(Created page with "Category:metabolite == Metabolite DNA-with-Uracils == * common-name: ** a uracil in dna == Reaction(s) known to consume the compound == * RXN0-2584 == Reaction(s) know...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-with-Uracils == |
* common-name: | * common-name: | ||
| − | ** | + | ** a uracil in dna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-2584]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a uracil in dna}} |
| − | |||
| − | |||
Revision as of 18:58, 14 January 2021
Contents
Metabolite DNA-with-Uracils
- common-name:
- a uracil in dna
