Difference between revisions of "Pyruvate-Dehydrogenase-Phosphoserine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-36 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(...") |
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLC == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-glucopyranose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wqzgkkkjijffok-vfuothlcsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
| + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.2.1.106-RXN]] | ||
| + | * [[ALDOSE-1-EPIMERASE-RXN]] | ||
| + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] | ||
| + | * [[TREHALA-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-glucopyranose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite GLC
- common-name:
- β-d-glucopyranose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-vfuothlcsa-n
- molecular-weight:
- 180.157
