Difference between revisions of "PLPSAL-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE] == * common-name: ** orotidine 5'-phosphate * smil...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == |
* common-name: | * common-name: | ||
− | ** | + | ** ferulate |
* smiles: | * smiles: | ||
− | ** | + | ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ksebmyqbyztdhs-hwkanzrosa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 193.179 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[6.2.1.34-RXN]] |
− | * [[ | + | * [[RXN-1121]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.1.1.73-RXN]] |
− | * [[ | + | * [[RXN-1104]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ferulate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=193.179}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite FERULIC-ACID
- common-name:
- ferulate
- smiles:
- coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
- inchi-key:
- ksebmyqbyztdhs-hwkanzrosa-m
- molecular-weight:
- 193.179