Difference between revisions of "GAMMA-LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-134 == * common-name: ** gibberellin a9 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](cc3)4)5)(c)))c([o-])=o))) * inch...") |
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GAMMA-LINOLENOYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-linolenoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzqyptbyqyzgru-fhdveodpsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1023.921 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12777]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.14.19.3-RXN]] | ||
| + | * [[RXN-16043]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-linolenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1023.921}} |
Revision as of 18:59, 14 January 2021
Contents
Metabolite GAMMA-LINOLENOYL-COA
- common-name:
- γ-linolenoyl-coa
- smiles:
- cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xzqyptbyqyzgru-fhdveodpsa-j
- molecular-weight:
- 1023.921
