Difference between revisions of "CPD-17348"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...") |
(Created page with "Category:metabolite == Metabolite 2-Hydroxy-carboxylates == * common-name: ** a 2-hydroxy carboxylate == Reaction(s) known to consume the compound == == Reaction(s) known...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-Hydroxy-carboxylates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-hydroxy carboxylate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7919]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-hydroxy carboxylate}} |
| − | |||
| − | |||
Revision as of 18:59, 14 January 2021
Contents
Metabolite 2-Hydroxy-carboxylates
- common-name:
- a 2-hydroxy carboxylate
