Difference between revisions of "PWY-7852"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] == * common-name: ** maltotetraose * smiles: ** c(c4(oc(oc3(c(oc(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * common-name: ** cholest-5-en-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** cholest-5-en-3-one
 
* smiles:
 
* smiles:
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
+
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** luewuzlmquobsb-ayqjavfrsa-n
+
** ggclnoigpmgldb-gykmgiidsa-n
 
* molecular-weight:
 
* molecular-weight:
** 666.583
+
** 384.644
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
+
* [[RXN-12693]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[RXN-12693]]
* [[RXN-14281]]
 
* [[RXN-14284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=cholest-5-en-3-one}}
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
+
{{#set: inchi-key=inchikey=ggclnoigpmgldb-gykmgiidsa-n}}
{{#set: molecular-weight=666.583}}
+
{{#set: molecular-weight=384.644}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-13684

  • common-name:
    • cholest-5-en-3-one
  • smiles:
    • cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • ggclnoigpmgldb-gykmgiidsa-n
  • molecular-weight:
    • 384.644

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality