Difference between revisions of "PWY-7831"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12125 CPD-12125] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] ==
 * common-name:
-** menaquinol-7
+** adenosine
 * smiles:
-** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
+** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
 * inchi-key:
-** vfgnpjrrtkmykn-ljwnyqgcsa-n
+** oirdtqyftabqoq-kqynxxcusa-n
 * molecular-weight:
-** 651.026
+** 267.244
 == Reaction(s) known to consume the compound ==
+* [[ADENODEAMIN-RXN]]
+* [[ADENOSINE-KINASE-RXN]]
+* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+* [[ADENPHOSPHOR-RXN]]
+* [[ADNK]]
+* [[ADNKm]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-9191]]
+* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+* [[ADENPHOSPHOR-RXN]]
+* [[AMP-DEPHOSPHORYLATION-RXN]]
+* [[AMP5N]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=menaquinol-7}}
+{{#set: common-name=adenosine}}
-{{#set: inchi-key=inchikey=vfgnpjrrtkmykn-ljwnyqgcsa-n}}
+{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}
-{{#set: molecular-weight=651.026}}
+{{#set: molecular-weight=267.244}}