Difference between revisions of "P163-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] == * common-name: ** 6-cis, 3-oxo-tridecenoyl-coa * smiles: ** ccccccc=ccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == * common-name: ** s-adenosyl 3-(methylthi...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == |
* common-name: | * common-name: | ||
− | ** | + | ** s-adenosyl 3-(methylthio)propylamine |
* smiles: | * smiles: | ||
− | ** | + | ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zunbitixdcpnsd-lsrjevitsa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 356.442 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[APAPT]] |
+ | * [[RXN-11190]] | ||
+ | * [[RXN0-5217]] | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
+ | * [[SPERMINE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AMCL]] | ||
+ | * [[RXN-11190]] | ||
+ | * [[SAMDECARB-RXN]] | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=s-adenosyl 3-(methylthio)propylamine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=356.442}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite S-ADENOSYLMETHIONINAMINE
- common-name:
- s-adenosyl 3-(methylthio)propylamine
- smiles:
- c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- zunbitixdcpnsd-lsrjevitsa-o
- molecular-weight:
- 356.442