Difference between revisions of "PWY-882"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-fMET-tRNAs Charged-fMET-tRNAs] == * common-name: ** an n-formyl-l-methionylaminoacyl-tr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-fMET-tRNAs Charged-fMET-tRNAs] ==
 
* common-name:
 
* common-name:
** 1,7-dimethylurate
+
** an n-formyl-l-methionylaminoacyl-trna
* smiles:
 
** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
 
* inchi-key:
 
** nofnclgcujjpku-uhfffaoysa-n
 
* molecular-weight:
 
** 196.165
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.5.1.27-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11520]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,7-dimethylurate}}
+
{{#set: common-name=an n-formyl-l-methionylaminoacyl-trna}}
{{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}}
 
{{#set: molecular-weight=196.165}}
 

Revision as of 14:19, 26 August 2019

Metabolite Charged-fMET-tRNAs

  • common-name:
    • an n-formyl-l-methionylaminoacyl-trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality