Difference between revisions of "CPD0-2350"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOBUTYRYL-COA == * common-name: ** 3-hydroxy-isobutanoyl-coa == Reaction(s) known to consume the compound == * RXN-13721 =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-L-KYNURENINE ==
+
== Metabolite 3-HYDROXY-ISOBUTYRYL-COA ==
 
* common-name:
 
* common-name:
** 3-hydroxy-l-kynurenine
+
** 3-hydroxy-isobutanoyl-coa
* smiles:
 
** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
 
* inchi-key:
 
** vckpuufaignjhc-lurjtmiesa-n
 
* molecular-weight:
 
** 224.216
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10721]]
+
* [[RXN-13721]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
 
* [[RXN-10721]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-l-kynurenine}}
+
{{#set: common-name=3-hydroxy-isobutanoyl-coa}}
{{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}}
 
{{#set: molecular-weight=224.216}}
 

Revision as of 11:12, 15 January 2021

Metabolite 3-HYDROXY-ISOBUTYRYL-COA

  • common-name:
    • 3-hydroxy-isobutanoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality