Difference between revisions of "CPD-8610"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Myelin-L-arginines == * common-name: ** [myelin basic protein]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.126-R...") |
(Created page with "Category:metabolite == Metabolite CPD-13404 == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o * inchi-key: ** xaewtdmgfghwfk-imjs...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13404 == |
* common-name: | * common-name: | ||
− | ** [ | + | ** l-alanyl-l-aspartate |
+ | * smiles: | ||
+ | ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o | ||
+ | * inchi-key: | ||
+ | ** xaewtdmgfghwfk-imjsidkusa-m | ||
+ | * molecular-weight: | ||
+ | ** 203.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-6975]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-aspartate}} |
+ | {{#set: inchi-key=inchikey=xaewtdmgfghwfk-imjsidkusa-m}} | ||
+ | {{#set: molecular-weight=203.174}} |
Revision as of 11:12, 15 January 2021
Contents
Metabolite CPD-13404
- common-name:
- l-alanyl-l-aspartate
- smiles:
- cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
- inchi-key:
- xaewtdmgfghwfk-imjsidkusa-m
- molecular-weight:
- 203.174