Difference between revisions of "Pyruvate-dehydrogenase-dihydrolipoate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Myosin-heavy-chain-phosphates == * common-name: ** a myosin-heavy chain-phosphate == Reaction(s) known to consume the compound == * 2.7...") |
(Created page with "Category:metabolite == Metabolite CPD-19170 == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-19170 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,7z)-hexadecenoyl-coa |
+ | * smiles: | ||
+ | ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** yqarrkbgbkpbcx-dvzfgldusa-j | ||
+ | * molecular-weight: | ||
+ | ** 997.883 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17780]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17779]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,7z)-hexadecenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}} | ||
+ | {{#set: molecular-weight=997.883}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite CPD-19170
- common-name:
- (2e,7z)-hexadecenoyl-coa
- smiles:
- ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- yqarrkbgbkpbcx-dvzfgldusa-j
- molecular-weight:
- 997.883