Difference between revisions of "CPD-7004"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-734 == * common-name: ** (-)-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-hwkxxfmvsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite THYMINE == * common-name: ** thymine * smiles: ** cc1(c(=o)nc(nc=1)=o) * inchi-key: ** rwqnbrdokxibiv-uhfffaoysa-n * molecular-weight: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THYMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** thymine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c(=o)nc(nc=1)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rwqnbrdokxibiv-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 126.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11049]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thymine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rwqnbrdokxibiv-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=126.115}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite THYMINE
- common-name:
- thymine
- smiles:
- cc1(c(=o)nc(nc=1)=o)
- inchi-key:
- rwqnbrdokxibiv-uhfffaoysa-n
- molecular-weight:
- 126.115
