Difference between revisions of "PWY-7174"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * common-name: ** 3-oxopentanoyl-coa * smiles: ** ccc(=o)cc(=o)sccnc(=o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytidine4-tRNAGly-GCC Cytidine4-tRNAGly-GCC] == * common-name: ** a cytidine4 in trnagly == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytidine4-tRNAGly-GCC Cytidine4-tRNAGly-GCC] ==
 
* common-name:
 
* common-name:
** 3-oxopentanoyl-coa
+
** a cytidine4 in trnagly
* smiles:
 
** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wioqnwtzboqteu-zmhdxicwsa-j
 
* molecular-weight:
 
** 861.604
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12561]]
+
* [[RXN-12478]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12560]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxopentanoyl-coa}}
+
{{#set: common-name=a cytidine4 in trnagly}}
{{#set: inchi-key=inchikey=wioqnwtzboqteu-zmhdxicwsa-j}}
 
{{#set: molecular-weight=861.604}}
 

Revision as of 14:19, 26 August 2019

Metabolite Cytidine4-tRNAGly-GCC

  • common-name:
    • a cytidine4 in trnagly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality