Difference between revisions of "L-XYLULOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11528 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-692 == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** rikwdzwvhuiuam-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-692 == |
* common-name: | * common-name: | ||
− | ** | + | ** (+)-cis-abscisic aldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rikwdzwvhuiuam-kicrzjjpsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 248.321 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[1.2.3.14-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[1.1.1.288-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(+)-cis-abscisic aldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=248.321}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-692
- common-name:
- (+)-cis-abscisic aldehyde
- smiles:
- cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
- inchi-key:
- rikwdzwvhuiuam-kicrzjjpsa-n
- molecular-weight:
- 248.321