Difference between revisions of "CPD-177"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13518 == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+])ccc([n+])c([o-])=o * inchi-key: ** fqwravymzulpnk-b...") |
(Created page with "Category:metabolite == Metabolite CPD-8564 == * smiles: ** c(=o)([a protein])c(n[a protein])co * common-name: ** a [myosin light-chain] l-serine == Reaction(s) known to co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8564 == |
| + | * smiles: | ||
| + | ** c(=o)([a protein])c(n[a protein])co | ||
* common-name: | * common-name: | ||
| − | ** | + | ** a [myosin light-chain] l-serine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.7.11.18-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.11.18-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [myosin light-chain] l-serine}} |
| − | |||
| − | |||
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-8564
- smiles:
- c(=o)([a protein])c(n[a protein])co
- common-name:
- a [myosin light-chain] l-serine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [myosin light-chain] l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
