Difference between revisions of "Phytoceramides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11281 == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** qbolvl...")
(Created page with "Category:metabolite == Metabolite CPD-7598 == * common-name: ** anandamide * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)ncco * inchi-key: ** lgeqqwmqcriykg-dofzraljsa-n * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11281 ==
+
== Metabolite CPD-7598 ==
 
* common-name:
 
* common-name:
** s-sulfanylglutathione
+
** anandamide
 
* smiles:
 
* smiles:
** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** cccccc=ccc=ccc=ccc=ccccc(=o)ncco
 
* inchi-key:
 
* inchi-key:
** qbolvlbsugjhgb-wdskdsinsa-m
+
** lgeqqwmqcriykg-dofzraljsa-n
 
* molecular-weight:
 
* molecular-weight:
** 338.373
+
** 347.54
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FESGSHTHIO-RXN]]
+
* [[RXN6666-2]]
* [[RXN-13161]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-sulfanylglutathione}}
+
{{#set: common-name=anandamide}}
{{#set: inchi-key=inchikey=qbolvlbsugjhgb-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=lgeqqwmqcriykg-dofzraljsa-n}}
{{#set: molecular-weight=338.373}}
+
{{#set: molecular-weight=347.54}}

Revision as of 11:15, 15 January 2021

Metabolite CPD-7598

  • common-name:
    • anandamide
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccc(=o)ncco
  • inchi-key:
    • lgeqqwmqcriykg-dofzraljsa-n
  • molecular-weight:
    • 347.54

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality