Difference between revisions of "PYRROLINE-HYDROXY-CARBOXYLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(...")
(Created page with "Category:metabolite == Metabolite CPD-18348 == * common-name: ** 1-cis-vaccenoylglycerol-3-phosphate * smiles: ** ccccccc=ccccccccccc(=o)occ(cop(=o)([o-])[o-])o * inchi-ke...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE ==
+
== Metabolite CPD-18348 ==
 
* common-name:
 
* common-name:
** 3-hexaprenyl-4-hydroxybenzoate
+
** 1-cis-vaccenoylglycerol-3-phosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
+
** ccccccc=ccccccccccc(=o)occ(cop(=o)([o-])[o-])o
 
* inchi-key:
 
* inchi-key:
** lkmqqqabigihgl-laaqxviisa-m
+
** lwsyatlsxcuntb-whxugtbjsa-l
 
* molecular-weight:
 
* molecular-weight:
** 545.824
+
** 434.509
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17009]]
 +
* [[RXN-17011]]
 +
* [[RXN-17013]]
 +
* [[RXN-17015]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9003]]
+
* [[RXN-17016]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=1-cis-vaccenoylglycerol-3-phosphate}}
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
+
{{#set: inchi-key=inchikey=lwsyatlsxcuntb-whxugtbjsa-l}}
{{#set: molecular-weight=545.824}}
+
{{#set: molecular-weight=434.509}}

Revision as of 11:15, 15 January 2021

Metabolite CPD-18348

  • common-name:
    • 1-cis-vaccenoylglycerol-3-phosphate
  • smiles:
    • ccccccc=ccccccccccc(=o)occ(cop(=o)([o-])[o-])o
  • inchi-key:
    • lwsyatlsxcuntb-whxugtbjsa-l
  • molecular-weight:
    • 434.509

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality