Difference between revisions of "Guanine46-in-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Monoamines == * common-name: ** a monoamine == Reaction(s) known to consume the compound == * RXN-9598 == Reaction(s) known to produc...") |
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O == * common-name: ** prostaglandin d2 * smiles: ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O == |
* common-name: | * common-name: | ||
| − | ** | + | ** prostaglandin d2 |
| + | * smiles: | ||
| + | ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) | ||
| + | * inchi-key: | ||
| + | ** bhmbvrspmrccgg-outuxvnysa-m | ||
| + | * molecular-weight: | ||
| + | ** 351.462 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.1.1.188-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.1.1.188-RXN]] | ||
| + | * [[PROSTAGLANDIN-D-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=prostaglandin d2}} |
| + | {{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}} | ||
| + | {{#set: molecular-weight=351.462}} | ||
Revision as of 11:15, 15 January 2021
Contents
Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O
- common-name:
- prostaglandin d2
- smiles:
- cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
- inchi-key:
- bhmbvrspmrccgg-outuxvnysa-m
- molecular-weight:
- 351.462
