Difference between revisions of "CPD-323"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Long-Chain-Acyl-Ethyl-Esters == * common-name: ** a long-chain acyl ethyl ester == Reaction(s) known to consume the compound == == Reacti...") |
(Created page with "Category:metabolite == Metabolite CPD-7535 == * common-name: ** 9,15,9'-tri-cis-ζ-carotene * smiles: ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7535 == |
* common-name: | * common-name: | ||
− | ** | + | ** 9,15,9'-tri-cis-ζ-carotene |
+ | * smiles: | ||
+ | ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** biwlelkafxrpde-lmarsqgmsa-n | ||
+ | * molecular-weight: | ||
+ | ** 540.914 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-11354]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11354]] |
+ | * [[RXN-11355]] | ||
+ | * [[RXN-12244]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=9,15,9'-tri-cis-ζ-carotene}} |
+ | {{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}} | ||
+ | {{#set: molecular-weight=540.914}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-7535
- common-name:
- 9,15,9'-tri-cis-ζ-carotene
- smiles:
- cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- biwlelkafxrpde-lmarsqgmsa-n
- molecular-weight:
- 540.914