Difference between revisions of "RIBULOSE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17545 == * common-name: ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine * smiles: ** c([n+])c(c([o-])=o)nc(=o)c1(oc(...") |
(Created page with "Category:metabolite == Metabolite CPD-13406 == * common-name: ** glycyl-l-aspartate * smiles: ** c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-] * inchi-key: ** sccpdjaqcxwptf-vkhmyhe...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13406 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-aspartate |
* smiles: | * smiles: | ||
| − | ** c([n+])c( | + | ** c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sccpdjaqcxwptf-vkhmyheasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.147 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6987]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-aspartate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sccpdjaqcxwptf-vkhmyheasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.147}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-13406
- common-name:
- glycyl-l-aspartate
- smiles:
- c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-]
- inchi-key:
- sccpdjaqcxwptf-vkhmyheasa-m
- molecular-weight:
- 189.147
