Difference between revisions of "CPD-10279"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...")
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: ** coc1(=c(o)c=cc(c(o)c=o)=c1) * inchi-key: ** visajvapy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DADP ==
+
== Metabolite CPD-11876 ==
 
* common-name:
 
* common-name:
** dadp
+
** 3-methoxy-4-hydroxyphenylglycolaldehyde
 
* smiles:
 
* smiles:
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
+
** coc1(=c(o)c=cc(c(o)c=o)=c1)
 
* inchi-key:
 
* inchi-key:
** daeapnuqqaicnr-rrkcrqdmsa-k
+
** visajvapypfkcl-qmmmgpobsa-n
 
* molecular-weight:
 
* molecular-weight:
** 408.18
+
** 182.176
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DADPKIN-RXN]]
+
* [[RXN-10915]]
* [[DATPtm]]
+
* [[RXN-10917]]
* [[NDPK]]
 
* [[NDPKm]]
 
* [[RXN-14192]]
 
* [[RXN-14215]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADPREDUCT-RXN]]
+
* [[RXN-10910]]
* [[ATDAM]]
+
* [[RXN-10913]]
* [[DAOTO]]
+
* [[RXN-10915]]
* [[DATCY]]
 
* [[DATPtm]]
 
* [[DATUP]]
 
* [[DEOXYADENYLATE-KINASE-RXN]]
 
* [[RXN-14214]]
 
* [[RXN0-747]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dadp}}
+
{{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}
+
{{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}}
{{#set: molecular-weight=408.18}}
+
{{#set: molecular-weight=182.176}}

Revision as of 11:15, 15 January 2021

Metabolite CPD-11876

  • common-name:
    • 3-methoxy-4-hydroxyphenylglycolaldehyde
  • smiles:
    • coc1(=c(o)c=cc(c(o)c=o)=c1)
  • inchi-key:
    • visajvapypfkcl-qmmmgpobsa-n
  • molecular-weight:
    • 182.176

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality