Difference between revisions of "CPD-19167"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * smiles: ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15666 ==
+
== Metabolite DEAMIDO-NAD ==
 
* common-name:
 
* common-name:
** 2-trans,6-cis-tridecadienoyl-coa
+
** nicotinate adenine dinucleotide
 
* smiles:
 
* smiles:
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
 
* inchi-key:
 
* inchi-key:
** oosdlbaxvxkfib-gtubxknvsa-j
+
** senpvezbrzqvst-hisdbwnosa-l
 
* molecular-weight:
 
* molecular-weight:
** 955.803
+
** 662.399
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14772]]
+
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14771]]
+
* [[NICONUCADENYLYLTRAN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
+
{{#set: common-name=nicotinate adenine dinucleotide}}
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}
+
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
{{#set: molecular-weight=955.803}}
+
{{#set: molecular-weight=662.399}}

Revision as of 11:15, 15 January 2021

Metabolite DEAMIDO-NAD

  • common-name:
    • nicotinate adenine dinucleotide
  • smiles:
    • c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
  • inchi-key:
    • senpvezbrzqvst-hisdbwnosa-l
  • molecular-weight:
    • 662.399

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality