Difference between revisions of "3-oxo-behenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE == * common-name: ** (r)-1-amino-2-propanol o-2-phosphate * smiles: ** cc(c[n+])op(=o)([o-])[o-] * inchi-k...") |
(Created page with "Category:metabolite == Metabolite CPD-13394 == * common-name: ** glycyl-l-glutamine * smiles: ** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** pnmuaggsdzxthx-bypyzucns...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13394 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-glutamine |
* smiles: | * smiles: | ||
| − | ** | + | ** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pnmuaggsdzxthx-bypyzucnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6983]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-glutamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pnmuaggsdzxthx-bypyzucnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.197}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-13394
- common-name:
- glycyl-l-glutamine
- smiles:
- c([n+])c(=o)nc(c([o-])=o)ccc(=o)n
- inchi-key:
- pnmuaggsdzxthx-bypyzucnsa-n
- molecular-weight:
- 203.197
