Difference between revisions of "CPD-556"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite ACETYL-ACP == * common-name: ** an acetyl-[acp] == Reaction(s) known to consume the compound == * 3-OXOACYL-ACP-SYNTH-BASE-RXN * AC...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2121 ==
+
== Metabolite ACETYL-ACP ==
 
* common-name:
 
* common-name:
** trans-hex-2-enoyl-coa
+
** an acetyl-[acp]
* smiles:
 
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** oinxhibnzuuimr-ixuyqxaasa-j
 
* molecular-weight:
 
** 859.631
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH2h]]
+
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
* [[RXN-12559]]
+
* [[ACP-S-ACETYLTRANSFER-RXN]]
* [[RXN-14278]]
 
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH2h]]
+
* [[ACP-S-ACETYLTRANSFER-RXN]]
* [[RXN-12567]]
 
* [[RXN-14278]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-hex-2-enoyl-coa}}
+
{{#set: common-name=an acetyl-[acp]}}
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
 
{{#set: molecular-weight=859.631}}
 

Revision as of 11:15, 15 January 2021

Metabolite ACETYL-ACP

  • common-name:
    • an acetyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an acetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.