Difference between revisions of "CPD-15687"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDMETA-13652 == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) * i...") |
(Created page with "Category:metabolite == Metabolite S2O3 == * common-name: ** thiosulfate * smiles: ** o=s(=o)([o-])s * inchi-key: ** dhcdfwkwkrszhf-uhfffaoysa-m * molecular-weight: ** 113....") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S2O3 == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiosulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** o=s(=o)([o-])s |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dhcdfwkwkrszhf-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 113.126 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SULFOCYS-RXN]] | ||
| + | * [[THIOSULFATE-SULFURTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[SULFOCYS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiosulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dhcdfwkwkrszhf-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=113.126}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite S2O3
- common-name:
- thiosulfate
- smiles:
- o=s(=o)([o-])s
- inchi-key:
- dhcdfwkwkrszhf-uhfffaoysa-m
- molecular-weight:
- 113.126
