Difference between revisions of "Myo-inositol-polyphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-665 == * common-name: ** 1-propanal * smiles: ** cc[ch]=o * inchi-key: ** nbbjymsmwiiqgu-uhfffaoysa-n * molecular-weight: ** 58.08 ==...")
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-665 ==
+
== Metabolite CANAVANINOSUCCINATE ==
 
* common-name:
 
* common-name:
** 1-propanal
+
** canavaninosuccinate
 
* smiles:
 
* smiles:
** cc[ch]=o
+
** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** nbbjymsmwiiqgu-uhfffaoysa-n
+
** sgymgugigtwwlu-rolxfiacsa-m
 
* molecular-weight:
 
* molecular-weight:
** 58.08
+
** 291.24
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13198]]
+
* [[RXN-22]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13198]]
+
* [[RXN-10]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-propanal}}
+
{{#set: common-name=canavaninosuccinate}}
{{#set: inchi-key=inchikey=nbbjymsmwiiqgu-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}}
{{#set: molecular-weight=58.08}}
+
{{#set: molecular-weight=291.24}}

Revision as of 11:16, 15 January 2021

Metabolite CANAVANINOSUCCINATE

  • common-name:
    • canavaninosuccinate
  • smiles:
    • c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
  • inchi-key:
    • sgymgugigtwwlu-rolxfiacsa-m
  • molecular-weight:
    • 291.24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality