Difference between revisions of "N-SUCCINYL-2-AMINO-6-KETOPIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19147 == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite Mannosyl8-Nacetylglucosaminyl2 == == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 3.2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19147 ==
+
== Metabolite Mannosyl8-Nacetylglucosaminyl2 ==
* common-name:
 
** (7z)-tetradecenoyl-coa
 
* smiles:
 
** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jpihvkickvpffy-twafkmgksa-j
 
* molecular-weight:
 
** 971.845
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17792]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17791]]
+
* [[3.2.1.113-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(7z)-tetradecenoyl-coa}}
 
{{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}}
 
{{#set: molecular-weight=971.845}}
 

Revision as of 11:16, 15 January 2021

Metabolite Mannosyl8-Nacetylglucosaminyl2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality