Difference between revisions of "Beta-L-arabinosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(c(cccccc([o-])=o)[n+])[n+] * inchi-key: ** kcegbpiygiwcdh-uh...") |
(Created page with "Category:metabolite == Metabolite METHYLARSONITE == * common-name: ** methylarsonite * smiles: ** c[as](o)o * inchi-key: ** oxbirpqqkcqwgv-uhfffaoysa-n * molecular-weight:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite METHYLARSONITE == |
* common-name: | * common-name: | ||
− | ** | + | ** methylarsonite |
* smiles: | * smiles: | ||
− | ** | + | ** c[as](o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oxbirpqqkcqwgv-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 123.971 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.1.1.138-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=methylarsonite}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oxbirpqqkcqwgv-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=123.971}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite METHYLARSONITE
- common-name:
- methylarsonite
- smiles:
- c[as](o)o
- inchi-key:
- oxbirpqqkcqwgv-uhfffaoysa-n
- molecular-weight:
- 123.971