Difference between revisions of "TRNA-precursors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15369 == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite Oleoyl-lipid == * common-name: ** a [glycerolipid]-oleate == Reaction(s) known to consume the compound == * RXN-7421 * RXN-9669 *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15369 ==
+
== Metabolite Oleoyl-lipid ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-lesqueroloyl-coa
+
** a [glycerolipid]-oleate
* smiles:
 
** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** chmqnmkvoyfhhx-sgpqcwjrsa-j
 
* molecular-weight:
 
** 1088.005
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14494]]
+
* [[RXN-7421]]
 +
* [[RXN-9669]]
 +
* [[RXN-9670]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14493]]
+
* [[RXN-9670]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-lesqueroloyl-coa}}
+
{{#set: common-name=a [glycerolipid]-oleate}}
{{#set: inchi-key=inchikey=chmqnmkvoyfhhx-sgpqcwjrsa-j}}
 
{{#set: molecular-weight=1088.005}}
 

Revision as of 11:16, 15 January 2021

Metabolite Oleoyl-lipid

  • common-name:
    • a [glycerolipid]-oleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-oleate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.