Difference between revisions of "Nonmethylated-Ribosomal-Protein-L11s"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-23713 == == Reaction(s) known to consume the compound == * RXN-21834 == Reaction(s) known to produce the compound == * RXN-2183...") |
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-DEHYDRO-SHIKIMATE == |
+ | * common-name: | ||
+ | ** 3-dehydroshikimate | ||
+ | * smiles: | ||
+ | ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) | ||
+ | * inchi-key: | ||
+ | ** slwwjzmphjjoph-phdidxhhsa-m | ||
+ | * molecular-weight: | ||
+ | ** 171.129 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
+ | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
+ | * [[RXN-7968]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=3-dehydroshikimate}} | ||
+ | {{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}} | ||
+ | {{#set: molecular-weight=171.129}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite 3-DEHYDRO-SHIKIMATE
- common-name:
- 3-dehydroshikimate
- smiles:
- c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
- inchi-key:
- slwwjzmphjjoph-phdidxhhsa-m
- molecular-weight:
- 171.129