Difference between revisions of "NMNH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-palmitoyl-ACPs == * common-name: ** a 3-oxo-palmitoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9540 == React...") |
(Created page with "Category:metabolite == Metabolite CPD-7279 == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o * inchi-key: ** ztalkmxohwqnia-t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7279 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-cis,4-trans-xanthoxin |
| + | * smiles: | ||
| + | ** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o | ||
| + | * inchi-key: | ||
| + | ** ztalkmxohwqnia-tvbshjcbsa-n | ||
| + | * molecular-weight: | ||
| + | ** 250.337 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.1.1.288-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-698]] |
| − | * [[RXN- | + | * [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-cis,4-trans-xanthoxin}} |
| + | {{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}} | ||
| + | {{#set: molecular-weight=250.337}} | ||
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-7279
- common-name:
- 2-cis,4-trans-xanthoxin
- smiles:
- cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
- inchi-key:
- ztalkmxohwqnia-tvbshjcbsa-n
- molecular-weight:
- 250.337
