Difference between revisions of "Holo-EntB"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * smiles: ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc...")
(Created page with "Category:metabolite == Metabolite L-arabinopyranose == == Reaction(s) known to consume the compound == * RXN-8772 == Reaction(s) known to produce the compound == * R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
+
== Metabolite L-arabinopyranose ==
* common-name:
 
** luteolin 7-o-β-d-diglucuronide
 
* smiles:
 
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 
* inchi-key:
 
** pbbvwjqpazyqdb-dbfweqbmsa-l
 
* molecular-weight:
 
** 636.476
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15288]]
+
* [[RXN-8772]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8772]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
 
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
 
{{#set: molecular-weight=636.476}}
 

Revision as of 11:17, 15 January 2021

Metabolite L-arabinopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality