Difference between revisions of "HX"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12124 == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c...")
(Created page with "Category:metabolite == Metabolite Detyrosinated-alpha--tubulins == * common-name: ** detyrosinated α-tubulin == Reaction(s) known to consume the compound == * 6.3....")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12124 ==
+
== Metabolite Detyrosinated-alpha--tubulins ==
 
* common-name:
 
* common-name:
** menaquinol-6
+
** detyrosinated α-tubulin
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
 
* inchi-key:
 
** zventdgzqvbwna-rciygobdsa-n
 
* molecular-weight:
 
** 582.908
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[6.3.2.25-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9220]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-6}}
+
{{#set: common-name=detyrosinated α-tubulin}}
{{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}}
 
{{#set: molecular-weight=582.908}}
 

Revision as of 11:17, 15 January 2021

Metabolite Detyrosinated-alpha--tubulins

  • common-name:
    • detyrosinated α-tubulin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality