Difference between revisions of "2-OXOBUTANOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](ccccc(c([o-])=o)[n+])(c)c * inchi-key: ** m...")
(Created page with "Category:metabolite == Metabolite CPD-16758 == * common-name: ** 2/3-phospho-d-glycerate == Reaction(s) known to consume the compound == * RXN-15509 * RXN-15512 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N6N6N6-TRIMETHYL-L-LYSINE ==
+
== Metabolite CPD-16758 ==
 
* common-name:
 
* common-name:
** n6,n6,n6-trimethyl-l-lysine
+
** 2/3-phospho-d-glycerate
* smiles:
 
** c[n+](ccccc(c([o-])=o)[n+])(c)c
 
* inchi-key:
 
** mxnrlfusfkvqsk-qmmmgpobsa-o
 
* molecular-weight:
 
** 189.277
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+
* [[RXN-15509]]
 +
* [[RXN-15512]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15509]]
 +
* [[RXN-15512]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=2/3-phospho-d-glycerate}}
{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
 
{{#set: molecular-weight=189.277}}
 

Revision as of 11:18, 15 January 2021

Metabolite CPD-16758

  • common-name:
    • 2/3-phospho-d-glycerate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality