Difference between revisions of "CPD-564"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17347 == * common-name: ** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)...")
(Created page with "Category:metabolite == Metabolite 4-ALPHA-METHYL-5-ALPHA == * common-name: ** 4α-methyl-5α-cholest-7-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17347 ==
+
== Metabolite 4-ALPHA-METHYL-5-ALPHA ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa
+
** 4α-methyl-5α-cholest-7-en-3β-ol
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc([ch]4(c1(c)([ch](c2([ch](cc1)c3(c)([ch](cc=2)c(c)c(o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** mntslnsvzacncx-jpddaygwsa-j
+
** lmyzqunlygjihi-sponxpensa-n
 
* molecular-weight:
 
* molecular-weight:
** 1069.99
+
** 400.687
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16096]]
+
* [[1.1.1.270-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16095]]
+
* [[1.1.1.270-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa}}
+
{{#set: common-name=4α-methyl-5α-cholest-7-en-3β-ol}}
{{#set: inchi-key=inchikey=mntslnsvzacncx-jpddaygwsa-j}}
+
{{#set: inchi-key=inchikey=lmyzqunlygjihi-sponxpensa-n}}
{{#set: molecular-weight=1069.99}}
+
{{#set: molecular-weight=400.687}}

Revision as of 11:18, 15 January 2021

Metabolite 4-ALPHA-METHYL-5-ALPHA

  • common-name:
    • 4α-methyl-5α-cholest-7-en-3β-ol
  • smiles:
    • cc(c)cccc([ch]4(c1(c)([ch](c2([ch](cc1)c3(c)([ch](cc=2)c(c)c(o)cc3)))cc4)))c
  • inchi-key:
    • lmyzqunlygjihi-sponxpensa-n
  • molecular-weight:
    • 400.687

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality