Difference between revisions of "CPD-68"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20012 == * common-name: ** naringenin chalcone * smiles: ** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o) * inchi-key: ** yqhmwtpy...")
(Created page with "Category:metabolite == Metabolite BR- == * common-name: ** bromide * smiles: ** [br-] * inchi-key: ** cpelxlsauqhcox-uhfffaoysa-m * molecular-weight: ** 79.904 == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20012 ==
+
== Metabolite BR- ==
 
* common-name:
 
* common-name:
** naringenin chalcone
+
** bromide
 
* smiles:
 
* smiles:
** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o)
+
** [br-]
 
* inchi-key:
 
* inchi-key:
** yqhmwtpyorbcmf-zzxkwvifsa-n
+
** cpelxlsauqhcox-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 272.257
+
** 79.904
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[APIGNAR-RXN]]
+
* [[RXN-11268]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=naringenin chalcone}}
+
{{#set: common-name=bromide}}
{{#set: inchi-key=inchikey=yqhmwtpyorbcmf-zzxkwvifsa-n}}
+
{{#set: inchi-key=inchikey=cpelxlsauqhcox-uhfffaoysa-m}}
{{#set: molecular-weight=272.257}}
+
{{#set: molecular-weight=79.904}}

Revision as of 11:18, 15 January 2021

Metabolite BR-

  • common-name:
    • bromide
  • smiles:
    • [br-]
  • inchi-key:
    • cpelxlsauqhcox-uhfffaoysa-m
  • molecular-weight:
    • 79.904

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality