Difference between revisions of "Cytosine-34-tRNA-Precursors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15365 ==
+
== Metabolite D-6-P-GLUCONO-DELTA-LACTONE ==
 
* common-name:
 
* common-name:
** densipoloyl-coa
+
** 6-phospho d-glucono-1,5-lactone
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
 
* inchi-key:
 
* inchi-key:
** qebzgoipmjeisg-apevuuacsa-j
+
** ijojivndfqsgab-sqougzdysa-l
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 256.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16150]]
+
* [[6PGLUCONOLACT-RXN]]
* [[RXN-16153]]
+
* [[RXN-14819]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16150]]
+
* [[G6PADH]]
 +
* [[G6PADHh]]
 +
* [[G6PBDH]]
 +
* [[G6PBDHh]]
 +
* [[GLU6PDEHYDROG-RXN]]
 +
* [[RXN-14819]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=densipoloyl-coa}}
+
{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
+
{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=256.105}}

Revision as of 11:18, 15 January 2021

Metabolite D-6-P-GLUCONO-DELTA-LACTONE

  • common-name:
    • 6-phospho d-glucono-1,5-lactone
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
  • inchi-key:
    • ijojivndfqsgab-sqougzdysa-l
  • molecular-weight:
    • 256.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality