Difference between revisions of "L-EPINEPHRINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Dermatan-NAcGal-46-disulfates == * common-name: ** [dermatan]-4,6-di-o-sulfo-n-acetyl-d-galactosamine == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite CPD-31 == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * inchi-key: ** xftrtwqbiomvpk-rxmqykedsa-l * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Dermatan-NAcGal-46-disulfates ==
+
== Metabolite CPD-31 ==
 
* common-name:
 
* common-name:
** [dermatan]-4,6-di-o-sulfo-n-acetyl-d-galactosamine
+
** (r)-citramalate
 +
* smiles:
 +
** cc(o)(c(=o)[o-])cc(=o)[o-]
 +
* inchi-key:
 +
** xftrtwqbiomvpk-rxmqykedsa-l
 +
* molecular-weight:
 +
** 146.099
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7953]]
+
* [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[dermatan]-4,6-di-o-sulfo-n-acetyl-d-galactosamine}}
+
{{#set: common-name=(r)-citramalate}}
 +
{{#set: inchi-key=inchikey=xftrtwqbiomvpk-rxmqykedsa-l}}
 +
{{#set: molecular-weight=146.099}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-31

  • common-name:
    • (r)-citramalate
  • smiles:
    • cc(o)(c(=o)[o-])cc(=o)[o-]
  • inchi-key:
    • xftrtwqbiomvpk-rxmqykedsa-l
  • molecular-weight:
    • 146.099

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality