Difference between revisions of "METHYL-GLYOXAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-31 == * common-name: ** (r)-citramalate * smiles: ** cc(o)(c(=o)[o-])cc(=o)[o-] * inchi-key: ** xftrtwqbiomvpk-rxmqykedsa-l * molecul...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-N3-methylpseudouridine1915 == * common-name: ** an n3-methylpseudouridine1915 in 23s rrna == Reaction(s) known to consume the co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 23S-rRNA-N3-methylpseudouridine1915 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n3-methylpseudouridine1915 in 23s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11592]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n3-methylpseudouridine1915 in 23s rrna}} |
| − | |||
| − | |||
Revision as of 18:58, 14 January 2021
Contents
Metabolite 23S-rRNA-N3-methylpseudouridine1915
- common-name:
- an n3-methylpseudouridine1915 in 23s rrna
