Difference between revisions of "THZ-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)...")
(Created page with "Category:metabolite == Metabolite METHYL-GLYOXAL == * common-name: ** methylglyoxal * smiles: ** cc([ch]=o)=o * inchi-key: ** aijulsrzwuxgpq-uhfffaoysa-n * molecular-weigh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3707 ==
+
== Metabolite METHYL-GLYOXAL ==
 
* common-name:
 
* common-name:
** adenosine 2',3'-cyclic monophosphate
+
** methylglyoxal
 
* smiles:
 
* smiles:
** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
+
** cc([ch]=o)=o
 
* inchi-key:
 
* inchi-key:
** kmywvddipvnlme-kqynxxcusa-m
+
** aijulsrzwuxgpq-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 328.201
+
** 72.063
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12057]]
+
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GLYOXIII-RXN]]
 +
* [[RXN-17627]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[RXN-17627]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=methylglyoxal}}
{{#set: inchi-key=inchikey=kmywvddipvnlme-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=aijulsrzwuxgpq-uhfffaoysa-n}}
{{#set: molecular-weight=328.201}}
+
{{#set: molecular-weight=72.063}}

Revision as of 18:58, 14 January 2021

Metabolite METHYL-GLYOXAL

  • common-name:
    • methylglyoxal
  • smiles:
    • cc([ch]=o)=o
  • inchi-key:
    • aijulsrzwuxgpq-uhfffaoysa-n
  • molecular-weight:
    • 72.063

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality