Difference between revisions of "Dodecanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Beta-adrenergic-receptors == * common-name: ** a β-adrenergic receptor == Reaction(s) known to consume the compound == * 2.7.11.15...")
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Beta-adrenergic-receptors ==
+
== Metabolite CPD-15424 ==
 
* common-name:
 
* common-name:
** a β-adrenergic receptor
+
** o-carbamoyladenylate
 +
* smiles:
 +
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
 +
* inchi-key:
 +
** chsnpofvfypelh-kqynxxcusa-m
 +
* molecular-weight:
 +
** 389.241
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.11.15-RXN]]
+
* [[RXN-13167]]
 +
* [[RXN-13168]]
 +
* [[RXN-14553]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.11.15-RXN]]
+
* [[RXN-14552]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a β-adrenergic receptor}}
+
{{#set: common-name=o-carbamoyladenylate}}
 +
{{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}}
 +
{{#set: molecular-weight=389.241}}

Revision as of 18:58, 14 January 2021

Metabolite CPD-15424

  • common-name:
    • o-carbamoyladenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
  • inchi-key:
    • chsnpofvfypelh-kqynxxcusa-m
  • molecular-weight:
    • 389.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality