Difference between revisions of "DTDP-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ == * common-name: ** vitamin k 2,3-epoxide * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c...")
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ ==
+
== Metabolite CPD-4207 ==
 
* common-name:
 
* common-name:
** vitamin k 2,3-epoxide
+
** isopentenyl adenosine
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
+
** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
 
* inchi-key:
 
* inchi-key:
** kutxfbihpwidjq-hbdfacptsa-n
+
** usvmjsalorzvdv-sdbhatresa-n
 
* molecular-weight:
 
* molecular-weight:
** 466.703
+
** 335.362
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
+
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
+
* [[RXN-4315]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=vitamin k 2,3-epoxide}}
+
{{#set: common-name=isopentenyl adenosine}}
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
+
{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
{{#set: molecular-weight=466.703}}
+
{{#set: molecular-weight=335.362}}

Revision as of 18:58, 14 January 2021

Metabolite CPD-4207

  • common-name:
    • isopentenyl adenosine
  • smiles:
    • cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
  • inchi-key:
    • usvmjsalorzvdv-sdbhatresa-n
  • molecular-weight:
    • 335.362

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality