Difference between revisions of "Phosphorylated-receptor-proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite CPD-8159 == * common-name: ** 1-palmitoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(=o)oc(coc(=o)cccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
+
== Metabolite CPD-8159 ==
 
* common-name:
 
* common-name:
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
+
** 1-palmitoyl-2-α-linolenoyl-phosphatidylcholine
 
* smiles:
 
* smiles:
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
+
** ccc=ccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c
 
* inchi-key:
 
* inchi-key:
** rqmcndrmpzbeod-uhfffaoysa-k
+
** jmaydgbzrhqjat-qwfqjeorsa-n
 
* molecular-weight:
 
* molecular-weight:
** 217.112
+
** 756.054
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2464]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2464]]
+
* [[RXN-8361]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
+
{{#set: common-name=1-palmitoyl-2-α-linolenoyl-phosphatidylcholine}}
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=jmaydgbzrhqjat-qwfqjeorsa-n}}
{{#set: molecular-weight=217.112}}
+
{{#set: molecular-weight=756.054}}

Revision as of 18:58, 14 January 2021

Metabolite CPD-8159

  • common-name:
    • 1-palmitoyl-2-α-linolenoyl-phosphatidylcholine
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c
  • inchi-key:
    • jmaydgbzrhqjat-qwfqjeorsa-n
  • molecular-weight:
    • 756.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality