Difference between revisions of "CPD0-2106"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...") |
(Created page with "Category:metabolite == Metabolite N4-N-ACETYL-BETA-D-GLUCOSAMINYL-F6 == * common-name: ** an n4-{β-d-glcnac-(1→2)-α-d-man-(1→3)-[β-d-glcnac-(1&ra...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N4-N-ACETYL-BETA-D-GLUCOSAMINYL-F6 == |
* common-name: | * common-name: | ||
− | ** 2- | + | ** an n4-{β-d-glcnac-(1→2)-α-d-man-(1→3)-[β-d-glcnac-(1→2)-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-[α-l-fuc-(1→6)]-β-d-glcnac}-l-asparaginyl-[protein] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.4.1.68-RXN]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2- | + | {{#set: common-name=an n4-{β-d-glcnac-(1→2)-α-d-man-(1→3)-[β-d-glcnac-(1→2)-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-[α-l-fuc-(1→6)]-β-d-glcnac}-l-asparaginyl-[protein]}} |
− | |||
− |
Revision as of 18:58, 14 January 2021
Contents
Metabolite N4-N-ACETYL-BETA-D-GLUCOSAMINYL-F6
- common-name:
- an n4-{β-d-glcnac-(1→2)-α-d-man-(1→3)-[β-d-glcnac-(1→2)-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-[α-l-fuc-(1→6)]-β-d-glcnac}-l-asparaginyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n4-{β-d-glcnac-(1→2)-α-d-man-(1→3)-[β-d-glcnac-(1→2)-α-d-man-(1→6)]-β-d-man-(1→4)-β-d-glcnac-(1→4)-[α-l-fuc-(1→6)]-β-d-glcnac}-l-asparaginyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.