Difference between revisions of "P3I"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-663 == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=...") |
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * common-name: ** 4-amino-4-deoxychorismate * smiles: ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-AMINO-4-DEOXYCHORISMATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-amino-4-deoxychorismate |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oiujhgolfkdbsu-htqzyqbosa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 224.193 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ADCLY-RXN]] |
| + | * [[PABASYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ADCLY-RXN]] |
| − | * [[ | + | * [[PABASYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-amino-4-deoxychorismate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oiujhgolfkdbsu-htqzyqbosa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.193}} |
Revision as of 18:59, 14 January 2021
Contents
Metabolite 4-AMINO-4-DEOXYCHORISMATE
- common-name:
- 4-amino-4-deoxychorismate
- smiles:
- c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1)
- inchi-key:
- oiujhgolfkdbsu-htqzyqbosa-m
- molecular-weight:
- 224.193
