Difference between revisions of "CPD-4186"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19161 == * common-name: ** (2e,7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
(Created page with "Category:metabolite == Metabolite S-GERANYLGERANYL-PROTEIN == * common-name: ** a [protein]-s-geranylgeranyl-l-cysteine == Reaction(s) known to consume the compound == * [...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19161 ==
+
== Metabolite S-GERANYLGERANYL-PROTEIN ==
 
* common-name:
 
* common-name:
** (2e,7z)-tetradecenoyl-coa
+
** a [protein]-s-geranylgeranyl-l-cysteine
* smiles:
 
** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** mwksuvqqmpjtpp-dtpvmwfysa-j
 
* molecular-weight:
 
** 969.83
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17793]]
+
* [[RXN-3701]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17792]]
+
* [[RXN-3701]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,7z)-tetradecenoyl-coa}}
+
{{#set: common-name=a [protein]-s-geranylgeranyl-l-cysteine}}
{{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}}
 
{{#set: molecular-weight=969.83}}
 

Revision as of 18:59, 14 January 2021

Metabolite S-GERANYLGERANYL-PROTEIN

  • common-name:
    • a [protein]-s-geranylgeranyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-s-geranylgeranyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.